C8H14F2N2O — CID 130487339
2-amino-3-(3,3-difluorocyclopentyl)propanamide (PubChem CID 130487339) has the molecular formula C8H14F2N2O and a molecular weight of 192.21 g/mol. Its IUPAC name is 2-amino-3-(3,3-difluorocyclopentyl)propanamide.
| Compound Name | 2-amino-3-(3,3-difluorocyclopentyl)propanamide |
|---|---|
| PubChem CID | 130487339 |
| Molecular Formula | C8H14F2N2O |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 2-amino-3-(3,3-difluorocyclopentyl)propanamide |
| SMILES | NC(=O)C(N)CC1CCC(F)(F)C1 |
| InChI | InChI=1S/C8H14F2N2O/c9-8(10)2-1-5(4-8)3-6(11)7(12)13/h5-6H,1-4,11H2,(H2,12,13) |
| InChIKey | PVGGKWBSSYMCOI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |