C14H24F2O — CID 114224509
1-cyclohexyl-3-(3,3-difluorocyclopentyl)propan-2-ol (PubChem CID 114224509) has the molecular formula C14H24F2O and a molecular weight of 246.34 g/mol. Its IUPAC name is 1-cyclohexyl-3-(3,3-difluorocyclopentyl)propan-2-ol.
| Compound Name | 1-cyclohexyl-3-(3,3-difluorocyclopentyl)propan-2-ol |
|---|---|
| PubChem CID | 114224509 |
| Molecular Formula | C14H24F2O |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 1-cyclohexyl-3-(3,3-difluorocyclopentyl)propan-2-ol |
| SMILES | OC(CC1CCCCC1)CC1CCC(F)(F)C1 |
| InChI | InChI=1S/C14H24F2O/c15-14(16)7-6-12(10-14)9-13(17)8-11-4-2-1-3-5-11/h11-13,17H,1-10H2 |
| InChIKey | HIJUVDKMLMLKCR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |