C13H22F2OS — CID 114225887
1-(3,3-difluorocyclopentyl)-3-(thian-4-yl)propan-2-ol (PubChem CID 114225887) has the molecular formula C13H22F2OS and a molecular weight of 264.38 g/mol. Its IUPAC name is 1-(3,3-difluorocyclopentyl)-3-(thian-4-yl)propan-2-ol.
| Compound Name | 1-(3,3-difluorocyclopentyl)-3-(thian-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 114225887 |
| Molecular Formula | C13H22F2OS |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 1-(3,3-difluorocyclopentyl)-3-(thian-4-yl)propan-2-ol |
| SMILES | OC(CC1CCSCC1)CC1CCC(F)(F)C1 |
| InChI | InChI=1S/C13H22F2OS/c14-13(15)4-1-11(9-13)8-12(16)7-10-2-5-17-6-3-10/h10-12,16H,1-9H2 |
| InChIKey | CSQGCFPWBTZELC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |