C9H14F4O — CID 127003791
1-(3,3-difluorocyclopentyl)-3,3-difluorobutan-2-ol (PubChem CID 127003791) has the molecular formula C9H14F4O and a molecular weight of 214.20 g/mol. Its IUPAC name is 1-(3,3-difluorocyclopentyl)-3,3-difluorobutan-2-ol.
| Compound Name | 1-(3,3-difluorocyclopentyl)-3,3-difluorobutan-2-ol |
|---|---|
| PubChem CID | 127003791 |
| Molecular Formula | C9H14F4O |
| Molecular Weight | 214.20 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 1-(3,3-difluorocyclopentyl)-3,3-difluorobutan-2-ol |
| SMILES | CC(F)(F)C(O)CC1CCC(F)(F)C1 |
| InChI | InChI=1S/C9H14F4O/c1-8(10,11)7(14)4-6-2-3-9(12,13)5-6/h6-7,14H,2-5H2,1H3 |
| InChIKey | APMCQENREVSJDM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.20 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |