C7H12F2O — CID 58879048
2-(3,3-difluorocyclopentyl)ethanol (PubChem CID 58879048) has the molecular formula C7H12F2O and a molecular weight of 150.17 g/mol. Its IUPAC name is 2-(3,3-difluorocyclopentyl)ethanol.
| Compound Name | 2-(3,3-difluorocyclopentyl)ethanol |
|---|---|
| PubChem CID | 58879048 |
| Molecular Formula | C7H12F2O |
| Molecular Weight | 150.17 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 2-(3,3-difluorocyclopentyl)ethanol |
| SMILES | OCCC1CCC(F)(F)C1 |
| InChI | InChI=1S/C7H12F2O/c8-7(9)3-1-6(5-7)2-4-10/h6,10H,1-5H2 |
| InChIKey | AHWGOIPCPVLXQR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.17 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |