C9H18F2O — CID 162726117
(4,4-difluorocyclohexyl)methanol;ethane (PubChem CID 162726117) has the molecular formula C9H18F2O and a molecular weight of 180.24 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl)methanol;ethane.
| Compound Name | (4,4-difluorocyclohexyl)methanol;ethane |
|---|---|
| PubChem CID | 162726117 |
| Molecular Formula | C9H18F2O |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | (4,4-difluorocyclohexyl)methanol;ethane |
| SMILES | CC.OCC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C7H12F2O.C2H6/c8-7(9)3-1-6(5-10)2-4-7;1-2/h6,10H,1-5H2;1-2H3 |
| InChIKey | VFUIWVXFYJWNQC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |