C7H12F2O3S — CID 154021800
(4,4-difluorocyclohexyl)methanesulfonic acid (PubChem CID 154021800) has the molecular formula C7H12F2O3S and a molecular weight of 214.23 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl)methanesulfonic acid.
| Compound Name | (4,4-difluorocyclohexyl)methanesulfonic acid |
|---|---|
| PubChem CID | 154021800 |
| Molecular Formula | C7H12F2O3S |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | (4,4-difluorocyclohexyl)methanesulfonic acid |
| SMILES | O=S(=O)(O)CC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C7H12F2O3S/c8-7(9)3-1-6(2-4-7)5-13(10,11)12/h6H,1-5H2,(H,10,11,12) |
| InChIKey | FZSKURGSGURTNO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|