C10H18F2O3S — CID 142689451
3-(4,4-difluorocyclohexyl)propyl methanesulfonate (PubChem CID 142689451) has the molecular formula C10H18F2O3S and a molecular weight of 256.31 g/mol. Its IUPAC name is 3-(4,4-difluorocyclohexyl)propyl methanesulfonate.
| Compound Name | 3-(4,4-difluorocyclohexyl)propyl methanesulfonate |
|---|---|
| PubChem CID | 142689451 |
| Molecular Formula | C10H18F2O3S |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 3-(4,4-difluorocyclohexyl)propyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCCC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C10H18F2O3S/c1-16(13,14)15-8-2-3-9-4-6-10(11,12)7-5-9/h9H,2-8H2,1H3 |
| InChIKey | ROXFHLCSMRYNBM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|