C10H18F3NO3S — CID 71500531
2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl methanesulfonate (PubChem CID 71500531) has the molecular formula C10H18F3NO3S and a molecular weight of 289.32 g/mol. Its IUPAC name is 2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl methanesulfonate.
| Compound Name | 2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 71500531 |
| Molecular Formula | C10H18F3NO3S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCC1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H18F3NO3S/c1-18(15,16)17-7-4-9-2-5-14(6-3-9)8-10(11,12)13/h9H,2-8H2,1H3 |
| InChIKey | WDBBLNLHEABYOE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|