C10H16F3NO2 — CID 122164232
methyl 2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]acetate (PubChem CID 122164232) has the molecular formula C10H16F3NO2 and a molecular weight of 239.24 g/mol. Its IUPAC name is methyl 2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]acetate.
| Compound Name | methyl 2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 122164232 |
| Molecular Formula | C10H16F3NO2 |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | methyl 2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]acetate |
| SMILES | COC(=O)CC1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H16F3NO2/c1-16-9(15)6-8-2-4-14(5-3-8)7-10(11,12)13/h8H,2-7H2,1H3 |
| InChIKey | DCLZRICNDCZHST-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |