C12H21F3N2O2 — CID 60782427
methyl 4-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]butanoate (PubChem CID 60782427) has the molecular formula C12H21F3N2O2 and a molecular weight of 282.31 g/mol. Its IUPAC name is methyl 4-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]butanoate.
| Compound Name | methyl 4-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]butanoate |
|---|---|
| PubChem CID | 60782427 |
| Molecular Formula | C12H21F3N2O2 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | methyl 4-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]butanoate |
| SMILES | COC(=O)CCCNC1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H21F3N2O2/c1-19-11(18)3-2-6-16-10-4-7-17(8-5-10)9-12(13,14)15/h10,16H,2-9H2,1H3 |
| InChIKey | XQALZPKIVVHGTB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|