methane;methyl 2-(1-methylpiperidin-4-yl)acetate

C10H21NO2 — CID 160918320

IUPACmethane;methyl 2-(1-methylpiperidin-4-yl)acetate
SMILESC.COC(=O)CC1CCN(C)CC1
InChIInChI=1S/C9H17NO2.CH4/c1-10-5-3-8(4-6-10)7-9(11)12-2;/h8H,3-7H2,1-2H3;1H4
InChIKeySRRWXKYJKGWCKH-UHFFFAOYSA-N
MW187.28 g/mol
LogP1.53
Rot. Bonds2

About methane;methyl 2-(1-methylpiperidin-4-yl)acetate

methane;methyl 2-(1-methylpiperidin-4-yl)acetate (PubChem CID 160918320) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is methane;methyl 2-(1-methylpiperidin-4-yl)acetate.

Molecular Properties

Compound Namemethane;methyl 2-(1-methylpiperidin-4-yl)acetate
PubChem CID160918320
Molecular FormulaC10H21NO2
Molecular Weight187.28 g/mol
Exact Mass187.16
IUPAC Namemethane;methyl 2-(1-methylpiperidin-4-yl)acetate
SMILESC.COC(=O)CC1CCN(C)CC1
InChIInChI=1S/C9H17NO2.CH4/c1-10-5-3-8(4-6-10)7-9(11)12-2;/h8H,3-7H2,1-2H3;1H4
InChIKeySRRWXKYJKGWCKH-UHFFFAOYSA-N
XLogP1.53
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500187.28
LogP ≤ 51.53
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methane;methyl 2-(1-methylpiperidin-4-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methane;methyl 2-(1-methylpiperidin-4-yl)acetate?
The IUPAC name of methane;methyl 2-(1-methylpiperidin-4-yl)acetate (CID 160918320) is methane;methyl 2-(1-methylpiperidin-4-yl)acetate.
What is the SMILES notation for methane;methyl 2-(1-methylpiperidin-4-yl)acetate?
The canonical SMILES for methane;methyl 2-(1-methylpiperidin-4-yl)acetate is C.COC(=O)CC1CCN(C)CC1.
What is the InChIKey of methane;methyl 2-(1-methylpiperidin-4-yl)acetate?
The InChIKey is SRRWXKYJKGWCKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.CH4/c1-10-5-3-8(4-6-10)7-9(11)12-2;/h8H,3-7H2,1-2H3;1H4.
What are the key properties of methane;methyl 2-(1-methylpiperidin-4-yl)acetate?
methane;methyl 2-(1-methylpiperidin-4-yl)acetate has a molecular weight of 187.28 g/mol, XLogP of 1.53, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;methyl 2-(1-methylpiperidin-4-yl)acetate is sourced from PubChem (CID 160918320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).