C12H26F3N — CID 142345486
ethane;4-methyl-1-(2,2,2-trifluoroethyl)piperidine (PubChem CID 142345486) has the molecular formula C12H26F3N and a molecular weight of 241.34 g/mol. Its IUPAC name is ethane;4-methyl-1-(2,2,2-trifluoroethyl)piperidine.
| Compound Name | ethane;4-methyl-1-(2,2,2-trifluoroethyl)piperidine |
|---|---|
| PubChem CID | 142345486 |
| Molecular Formula | C12H26F3N |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | ethane;4-methyl-1-(2,2,2-trifluoroethyl)piperidine |
| SMILES | CC.CC.CC1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C8H14F3N.2C2H6/c1-7-2-4-12(5-3-7)6-8(9,10)11;2*1-2/h7H,2-6H2,1H3;2*1-2H3 |
| InChIKey | CFUUPLVMYQBDRW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |