About [2-methyl-1-(4-methylpiperidin-1-yl)propan-2-yl]-λ2-stannane
[2-methyl-1-(4-methylpiperidin-1-yl)propan-2-yl]-λ2-stannane (PubChem CID 174710196) has the molecular formula C10H21NSn
and a molecular weight of 274.00 g/mol. Its IUPAC name is [2-methyl-1-(4-methylpiperidin-1-yl)propan-2-yl]-λ2-stannane.
Molecular Properties
| Compound Name | [2-methyl-1-(4-methylpiperidin-1-yl)propan-2-yl]-λ2-stannane |
| PubChem CID | 174710196 |
| Molecular Formula | C10H21NSn |
| Molecular Weight | 274.00 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | [2-methyl-1-(4-methylpiperidin-1-yl)propan-2-yl]-λ2-stannane |
| SMILES | CC1CCN(CC(C)(C)[SnH])CC1 |
| InChI | InChI=1S/C10H20N.Sn.H/c1-9(2)8-11-6-4-10(3)5-7-11;;/h10H,4-8H2,1-3H3;; |
| InChIKey | RLUBXPBAAXJSET-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.00 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [2-methyl-1-(4-methylpiperidin-1-yl)propan-2-yl]-λ2-stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methyl-1-(4-methylpiperidin-1-yl)propan-2-yl]-λ2-stannane?
The IUPAC name of [2-methyl-1-(4-methylpiperidin-1-yl)propan-2-yl]-λ2-stannane (CID 174710196) is [2-methyl-1-(4-methylpiperidin-1-yl)propan-2-yl]-λ2-stannane.
What is the SMILES notation for [2-methyl-1-(4-methylpiperidin-1-yl)propan-2-yl]-λ2-stannane?
The canonical SMILES for [2-methyl-1-(4-methylpiperidin-1-yl)propan-2-yl]-λ2-stannane is CC1CCN(CC(C)(C)[SnH])CC1.
What is the InChIKey of [2-methyl-1-(4-methylpiperidin-1-yl)propan-2-yl]-λ2-stannane?
The InChIKey is RLUBXPBAAXJSET-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N.Sn.H/c1-9(2)8-11-6-4-10(3)5-7-11;;/h10H,4-8H2,1-3H3;;.
What are the key properties of [2-methyl-1-(4-methylpiperidin-1-yl)propan-2-yl]-λ2-stannane?
[2-methyl-1-(4-methylpiperidin-1-yl)propan-2-yl]-λ2-stannane has a molecular weight of 274.00 g/mol, XLogP of 1.82, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methyl-1-(4-methylpiperidin-1-yl)propan-2-yl]-λ2-stannane is sourced from PubChem (CID 174710196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).