C9H16F2O3S — CID 171548869
(4,4-difluoro-1-methylcyclohexyl)methyl methanesulfonate (PubChem CID 171548869) has the molecular formula C9H16F2O3S and a molecular weight of 242.29 g/mol. Its IUPAC name is (4,4-difluoro-1-methylcyclohexyl)methyl methanesulfonate.
| Compound Name | (4,4-difluoro-1-methylcyclohexyl)methyl methanesulfonate |
|---|---|
| PubChem CID | 171548869 |
| Molecular Formula | C9H16F2O3S |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | (4,4-difluoro-1-methylcyclohexyl)methyl methanesulfonate |
| SMILES | CC1(COS(C)(=O)=O)CCC(F)(F)CC1 |
| InChI | InChI=1S/C9H16F2O3S/c1-8(7-14-15(2,12)13)3-5-9(10,11)6-4-8/h3-7H2,1-2H3 |
| InChIKey | RLGJWUIEOCDPFY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|