C8H14F2O3S — CID 146049274
[1-(1,1-difluoroethyl)cyclobutyl]methyl methanesulfonate (PubChem CID 146049274) has the molecular formula C8H14F2O3S and a molecular weight of 228.26 g/mol. Its IUPAC name is [1-(1,1-difluoroethyl)cyclobutyl]methyl methanesulfonate.
| Compound Name | [1-(1,1-difluoroethyl)cyclobutyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 146049274 |
| Molecular Formula | C8H14F2O3S |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | [1-(1,1-difluoroethyl)cyclobutyl]methyl methanesulfonate |
| SMILES | CC(F)(F)C1(COS(C)(=O)=O)CCC1 |
| InChI | InChI=1S/C8H14F2O3S/c1-7(9,10)8(4-3-5-8)6-13-14(2,11)12/h3-6H2,1-2H3 |
| InChIKey | SNCDJIWYAAYYNK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|