About 3-(trifluoromethyl)hexyl methanesulfonate
3-(trifluoromethyl)hexyl methanesulfonate (PubChem CID 59378439) has the molecular formula C8H15F3O3S
and a molecular weight of 248.27 g/mol. Its IUPAC name is 3-(trifluoromethyl)hexyl methanesulfonate.
Molecular Properties
| Compound Name | 3-(trifluoromethyl)hexyl methanesulfonate |
| PubChem CID | 59378439 |
| Molecular Formula | C8H15F3O3S |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 3-(trifluoromethyl)hexyl methanesulfonate |
| SMILES | CCCC(CCOS(C)(=O)=O)C(F)(F)F |
| InChI | InChI=1S/C8H15F3O3S/c1-3-4-7(8(9,10)11)5-6-14-15(2,12)13/h7H,3-6H2,1-2H3 |
| InChIKey | WTBXZUCWIBLTRG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(trifluoromethyl)hexyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(trifluoromethyl)hexyl methanesulfonate?
The IUPAC name of 3-(trifluoromethyl)hexyl methanesulfonate (CID 59378439) is 3-(trifluoromethyl)hexyl methanesulfonate.
What is the SMILES notation for 3-(trifluoromethyl)hexyl methanesulfonate?
The canonical SMILES for 3-(trifluoromethyl)hexyl methanesulfonate is CCCC(CCOS(C)(=O)=O)C(F)(F)F.
What is the InChIKey of 3-(trifluoromethyl)hexyl methanesulfonate?
The InChIKey is WTBXZUCWIBLTRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F3O3S/c1-3-4-7(8(9,10)11)5-6-14-15(2,12)13/h7H,3-6H2,1-2H3.
What are the key properties of 3-(trifluoromethyl)hexyl methanesulfonate?
3-(trifluoromethyl)hexyl methanesulfonate has a molecular weight of 248.27 g/mol, XLogP of 2.33, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(trifluoromethyl)hexyl methanesulfonate is sourced from PubChem (CID 59378439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).