C13H20F6O — CID 174927526
4,8-bis(trifluoromethyl)undecan-6-one (PubChem CID 174927526) has the molecular formula C13H20F6O and a molecular weight of 306.29 g/mol. Its IUPAC name is 4,8-bis(trifluoromethyl)undecan-6-one.
| Compound Name | 4,8-bis(trifluoromethyl)undecan-6-one |
|---|---|
| PubChem CID | 174927526 |
| Molecular Formula | C13H20F6O |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 4,8-bis(trifluoromethyl)undecan-6-one |
| SMILES | CCCC(CC(=O)CC(CCC)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H20F6O/c1-3-5-9(12(14,15)16)7-11(20)8-10(6-4-2)13(17,18)19/h9-10H,3-8H2,1-2H3 |
| InChIKey | HFFAUCAGHSDXQV-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |