C14H14F14O — CID 155453587
1,1,1,2,2,3,3,9,9,10,10,11,11,11-tetradecafluoro-4-propylundecan-6-one (PubChem CID 155453587) has the molecular formula C14H14F14O and a molecular weight of 464.24 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,9,9,10,10,11,11,11-tetradecafluoro-4-propylundecan-6-one.
| Compound Name | 1,1,1,2,2,3,3,9,9,10,10,11,11,11-tetradecafluoro-4-propylundecan-6-one |
|---|---|
| PubChem CID | 155453587 |
| Molecular Formula | C14H14F14O |
| Molecular Weight | 464.24 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | 1,1,1,2,2,3,3,9,9,10,10,11,11,11-tetradecafluoro-4-propylundecan-6-one |
| SMILES | CCCC(CC(=O)CCC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H14F14O/c1-2-3-7(10(17,18)12(21,22)14(26,27)28)6-8(29)4-5-9(15,16)11(19,20)13(23,24)25/h7H,2-6H2,1H3 |
| InChIKey | VBVZIFWZNLTVQX-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.24 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|