C12H21F3O — CID 79954755
6-ethyl-1,1,1-trifluorodecan-4-one (PubChem CID 79954755) has the molecular formula C12H21F3O and a molecular weight of 238.29 g/mol. Its IUPAC name is 6-ethyl-1,1,1-trifluorodecan-4-one.
| Compound Name | 6-ethyl-1,1,1-trifluorodecan-4-one |
|---|---|
| PubChem CID | 79954755 |
| Molecular Formula | C12H21F3O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 6-ethyl-1,1,1-trifluorodecan-4-one |
| SMILES | CCCCC(CC)CC(=O)CCC(F)(F)F |
| InChI | InChI=1S/C12H21F3O/c1-3-5-6-10(4-2)9-11(16)7-8-12(13,14)15/h10H,3-9H2,1-2H3 |
| InChIKey | BACDQSWGXACEJD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |