C11H20F3NO — CID 116577005
6-(aminomethyl)-1,1,1-trifluoro-8-methylnonan-4-one (PubChem CID 116577005) has the molecular formula C11H20F3NO and a molecular weight of 239.28 g/mol. Its IUPAC name is 6-(aminomethyl)-1,1,1-trifluoro-8-methylnonan-4-one.
| Compound Name | 6-(aminomethyl)-1,1,1-trifluoro-8-methylnonan-4-one |
|---|---|
| PubChem CID | 116577005 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 6-(aminomethyl)-1,1,1-trifluoro-8-methylnonan-4-one |
| SMILES | CC(C)CC(CN)CC(=O)CCC(F)(F)F |
| InChI | InChI=1S/C11H20F3NO/c1-8(2)5-9(7-15)6-10(16)3-4-11(12,13)14/h8-9H,3-7,15H2,1-2H3 |
| InChIKey | NHRGVDVUGDQCIE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |