C14H25F2NO — CID 139888232
7-amino-1-cyclohexyl-4,4-difluoro-6-methylheptan-3-one (PubChem CID 139888232) has the molecular formula C14H25F2NO and a molecular weight of 261.36 g/mol. Its IUPAC name is 7-amino-1-cyclohexyl-4,4-difluoro-6-methylheptan-3-one.
| Compound Name | 7-amino-1-cyclohexyl-4,4-difluoro-6-methylheptan-3-one |
|---|---|
| PubChem CID | 139888232 |
| Molecular Formula | C14H25F2NO |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | 7-amino-1-cyclohexyl-4,4-difluoro-6-methylheptan-3-one |
| SMILES | CC(CN)CC(F)(F)C(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C14H25F2NO/c1-11(10-17)9-14(15,16)13(18)8-7-12-5-3-2-4-6-12/h11-12H,2-10,17H2,1H3 |
| InChIKey | CCSYUZPQQVFKEY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |