C10H17F2NO — CID 121426448
(4R)-4-amino-4-(4,4-difluorocyclohexyl)butan-2-one (PubChem CID 121426448) has the molecular formula C10H17F2NO and a molecular weight of 205.25 g/mol. Its IUPAC name is (4R)-4-amino-4-(4,4-difluorocyclohexyl)butan-2-one.
| Compound Name | (4R)-4-amino-4-(4,4-difluorocyclohexyl)butan-2-one |
|---|---|
| PubChem CID | 121426448 |
| Molecular Formula | C10H17F2NO |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | (4R)-4-amino-4-(4,4-difluorocyclohexyl)butan-2-one |
| SMILES | CC(=O)C[C@@H](N)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C10H17F2NO/c1-7(14)6-9(13)8-2-4-10(11,12)5-3-8/h8-9H,2-6,13H2,1H3/t9-/m1/s1 |
| InChIKey | CCERRZKKNJIPIX-SECBINFHSA-N |
| XLogP | 2.12 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |