C9H15F2NO — CID 59115482
(1S)-1-amino-1-(4,4-difluorocyclohexyl)propan-2-one (PubChem CID 59115482) has the molecular formula C9H15F2NO and a molecular weight of 191.22 g/mol. Its IUPAC name is (1S)-1-amino-1-(4,4-difluorocyclohexyl)propan-2-one.
| Compound Name | (1S)-1-amino-1-(4,4-difluorocyclohexyl)propan-2-one |
|---|---|
| PubChem CID | 59115482 |
| Molecular Formula | C9H15F2NO |
| Molecular Weight | 191.22 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | (1S)-1-amino-1-(4,4-difluorocyclohexyl)propan-2-one |
| SMILES | CC(=O)[C@@H](N)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C9H15F2NO/c1-6(13)8(12)7-2-4-9(10,11)5-3-7/h7-8H,2-5,12H2,1H3/t8-/m1/s1 |
| InChIKey | KDHHFTCRIRLHED-MRVPVSSYSA-N |
| XLogP | 1.73 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |