C10H14F7NO — CID 21049854
N-(3,3,4,4,5,5,5-heptafluoropentyl)-2-methylbutanamide (PubChem CID 21049854) has the molecular formula C10H14F7NO and a molecular weight of 297.21 g/mol. Its IUPAC name is N-(3,3,4,4,5,5,5-heptafluoropentyl)-2-methylbutanamide.
| Compound Name | N-(3,3,4,4,5,5,5-heptafluoropentyl)-2-methylbutanamide |
|---|---|
| PubChem CID | 21049854 |
| Molecular Formula | C10H14F7NO |
| Molecular Weight | 297.21 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | N-(3,3,4,4,5,5,5-heptafluoropentyl)-2-methylbutanamide |
| SMILES | CCC(C)C(=O)NCCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H14F7NO/c1-3-6(2)7(19)18-5-4-8(11,12)9(13,14)10(15,16)17/h6H,3-5H2,1-2H3,(H,18,19) |
| InChIKey | KQJYNIJEEHRQSL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.21 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|