C7H10F7N — CID 150635872
N-ethyl-3,3,4,4,5,5,5-heptafluoropentan-1-amine (PubChem CID 150635872) has the molecular formula C7H10F7N and a molecular weight of 241.15 g/mol. Its IUPAC name is N-ethyl-3,3,4,4,5,5,5-heptafluoropentan-1-amine.
| Compound Name | N-ethyl-3,3,4,4,5,5,5-heptafluoropentan-1-amine |
|---|---|
| PubChem CID | 150635872 |
| Molecular Formula | C7H10F7N |
| Molecular Weight | 241.15 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | N-ethyl-3,3,4,4,5,5,5-heptafluoropentan-1-amine |
| SMILES | CCNCCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H10F7N/c1-2-15-4-3-5(8,9)6(10,11)7(12,13)14/h15H,2-4H2,1H3 |
| InChIKey | UDUWWKHINAPLFW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.15 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|