C14H13F18N — CID 118123637
N-ethyl-4,4,5,5,6,6,7,7,7-nonafluoro-2-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)heptan-1-amine (PubChem CID 118123637) has the molecular formula C14H13F18N and a molecular weight of 537.23 g/mol. Its IUPAC name is N-ethyl-4,4,5,5,6,6,7,7,7-nonafluoro-2-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)heptan-1-amine.
| Compound Name | N-ethyl-4,4,5,5,6,6,7,7,7-nonafluoro-2-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)heptan-1-amine |
|---|---|
| PubChem CID | 118123637 |
| Molecular Formula | C14H13F18N |
| Molecular Weight | 537.23 g/mol |
| Exact Mass | 537.08 |
| IUPAC Name | N-ethyl-4,4,5,5,6,6,7,7,7-nonafluoro-2-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)heptan-1-amine |
| SMILES | CCNCC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H13F18N/c1-2-33-5-6(3-7(15,16)9(19,20)11(23,24)13(27,28)29)4-8(17,18)10(21,22)12(25,26)14(30,31)32/h6,33H,2-5H2,1H3 |
| InChIKey | BKPIAHXCMLLZMS-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.23 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|