C11H11F13 — CID 58901254
1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-methyldecane (PubChem CID 58901254) has the molecular formula C11H11F13 and a molecular weight of 390.18 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-methyldecane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-methyldecane |
|---|---|
| PubChem CID | 58901254 |
| Molecular Formula | C11H11F13 |
| Molecular Weight | 390.18 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-methyldecane |
| SMILES | CCC(C)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H11F13/c1-3-5(2)4-6(12,13)7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)24/h5H,3-4H2,1-2H3 |
| InChIKey | FBMPIGRZBIJKAJ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.18 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|