C16H21F13 — CID 140594680
1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-9,9,11-trimethyltridecane (PubChem CID 140594680) has the molecular formula C16H21F13 and a molecular weight of 460.32 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-9,9,11-trimethyltridecane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-9,9,11-trimethyltridecane |
|---|---|
| PubChem CID | 140594680 |
| Molecular Formula | C16H21F13 |
| Molecular Weight | 460.32 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-9,9,11-trimethyltridecane |
| SMILES | CCC(C)CC(C)(C)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H21F13/c1-5-9(2)8-10(3,4)6-7-11(17,18)12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)29/h9H,5-8H2,1-4H3 |
| InChIKey | XFSNGUPXTQWZSY-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.32 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|