C28H32F26O — CID 87932263
1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-9,11-dimethyl-9-(7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-2,4-dimethyldodecan-4-yl)oxydodecane (PubChem CID 87932263) has the molecular formula C28H32F26O and a molecular weight of 878.51 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-9,11-dimethyl-9-(7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-2,4-dimethyldodecan-4-yl)oxydodecane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-9,11-dimethyl-9-(7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-2,4-dimethyldodecan-4-yl)oxydodecane |
|---|---|
| PubChem CID | 87932263 |
| Molecular Formula | C28H32F26O |
| Molecular Weight | 878.51 g/mol |
| Exact Mass | 878.20 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-9,11-dimethyl-9-(7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluoro-2,4-dimethyldodecan-4-yl)oxydodecane |
| SMILES | CC(C)CC(C)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC(C)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC(C)C |
| InChI | InChI=1S/C28H32F26O/c1-13(2)11-15(5,7-9-17(29,30)19(33,34)21(37,38)23(41,42)25(45,46)27(49,50)51)55-16(6,12-14(3)4)8-10-18(31,32)20(35,36)22(39,40)24(43,44)26(47,48)28(52,53)54/h13-14H,7-12H2,1-6H3 |
| InChIKey | QXSBZTJMASOCOE-UHFFFAOYSA-N |
| XLogP | 13.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.51 |
| LogP ≤ 5 | 13.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|