C16H8F26 — CID 131700766
1,1,1,2,2,3,3,4,4,5,5,6,6,10,10,11,11,12,12,13,13,14,14,15,15,15-hexacosafluoro-7-methylpentadecane (PubChem CID 131700766) has the molecular formula C16H8F26 and a molecular weight of 694.19 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6,10,10,11,11,12,12,13,13,14,14,15,15,15-hexacosafluoro-7-methylpentadecane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,10,10,11,11,12,12,13,13,14,14,15,15,15-hexacosafluoro-7-methylpentadecane |
|---|---|
| PubChem CID | 131700766 |
| Molecular Formula | C16H8F26 |
| Molecular Weight | 694.19 g/mol |
| Exact Mass | 694.02 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,10,10,11,11,12,12,13,13,14,14,15,15,15-hexacosafluoro-7-methylpentadecane |
| SMILES | CC(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H8F26/c1-4(6(19,20)8(23,24)10(27,28)12(31,32)14(35,36)16(40,41)42)2-3-5(17,18)7(21,22)9(25,26)11(29,30)13(33,34)15(37,38)39/h4H,2-3H2,1H3 |
| InChIKey | WXFFAMCZQVVAKS-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.19 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|