C12H15F11 — CID 177342292
1,1,1,2,2,3,3,4,4,5,5-undecafluoro-6-methylundecane (PubChem CID 177342292) has the molecular formula C12H15F11 and a molecular weight of 368.23 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5-undecafluoro-6-methylundecane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5-undecafluoro-6-methylundecane |
|---|---|
| PubChem CID | 177342292 |
| Molecular Formula | C12H15F11 |
| Molecular Weight | 368.23 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5-undecafluoro-6-methylundecane |
| SMILES | CCCCCC(C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H15F11/c1-3-4-5-6-7(2)8(13,14)9(15,16)10(17,18)11(19,20)12(21,22)23/h7H,3-6H2,1-2H3 |
| InChIKey | UHNFXZVVUZLZFB-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.23 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|