C16H22F11I — CID 153324190
6-ethyl-1,1,1,2,2,3,3,4,4,5,5-undecafluoro-7-iodotetradecane (PubChem CID 153324190) has the molecular formula C16H22F11I and a molecular weight of 550.23 g/mol. Its IUPAC name is 6-ethyl-1,1,1,2,2,3,3,4,4,5,5-undecafluoro-7-iodotetradecane.
| Compound Name | 6-ethyl-1,1,1,2,2,3,3,4,4,5,5-undecafluoro-7-iodotetradecane |
|---|---|
| PubChem CID | 153324190 |
| Molecular Formula | C16H22F11I |
| Molecular Weight | 550.23 g/mol |
| Exact Mass | 550.06 |
| IUPAC Name | 6-ethyl-1,1,1,2,2,3,3,4,4,5,5-undecafluoro-7-iodotetradecane |
| SMILES | CCCCCCCC(I)C(CC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H22F11I/c1-3-5-6-7-8-9-11(28)10(4-2)12(17,18)13(19,20)14(21,22)15(23,24)16(25,26)27/h10-11H,3-9H2,1-2H3 |
| InChIKey | JXXUMJWDCLRRFL-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.23 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|