C17H24F11I — CID 153324172
1,1,1,2,2,3,3,4-octafluoro-6-iodo-5-methyl-4-(trifluoromethyl)pentadecane (PubChem CID 153324172) has the molecular formula C17H24F11I and a molecular weight of 564.26 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4-octafluoro-6-iodo-5-methyl-4-(trifluoromethyl)pentadecane.
| Compound Name | 1,1,1,2,2,3,3,4-octafluoro-6-iodo-5-methyl-4-(trifluoromethyl)pentadecane |
|---|---|
| PubChem CID | 153324172 |
| Molecular Formula | C17H24F11I |
| Molecular Weight | 564.26 g/mol |
| Exact Mass | 564.07 |
| IUPAC Name | 1,1,1,2,2,3,3,4-octafluoro-6-iodo-5-methyl-4-(trifluoromethyl)pentadecane |
| SMILES | CCCCCCCCCC(I)C(C)C(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H24F11I/c1-3-4-5-6-7-8-9-10-12(29)11(2)13(18,16(23,24)25)14(19,20)15(21,22)17(26,27)28/h11-12H,3-10H2,1-2H3 |
| InChIKey | OMARSGQAMOLFGC-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.26 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|