C12H20F5I — CID 151146278
3-ethyl-1,1,1,2,2-pentafluoro-4-iododecane (PubChem CID 151146278) has the molecular formula C12H20F5I and a molecular weight of 386.19 g/mol. Its IUPAC name is 3-ethyl-1,1,1,2,2-pentafluoro-4-iododecane.
| Compound Name | 3-ethyl-1,1,1,2,2-pentafluoro-4-iododecane |
|---|---|
| PubChem CID | 151146278 |
| Molecular Formula | C12H20F5I |
| Molecular Weight | 386.19 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 3-ethyl-1,1,1,2,2-pentafluoro-4-iododecane |
| SMILES | CCCCCCC(I)C(CC)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H20F5I/c1-3-5-6-7-8-10(18)9(4-2)11(13,14)12(15,16)17/h9-10H,3-8H2,1-2H3 |
| InChIKey | MXGPWBZXSAJXMR-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.19 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|