C10H10F12 — CID 175798759
1,1,1,2,2,3,3,4,4,5,5,6-dodecafluorodecane (PubChem CID 175798759) has the molecular formula C10H10F12 and a molecular weight of 358.17 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6-dodecafluorodecane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6-dodecafluorodecane |
|---|---|
| PubChem CID | 175798759 |
| Molecular Formula | C10H10F12 |
| Molecular Weight | 358.17 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6-dodecafluorodecane |
| SMILES | CCCCC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H10F12/c1-2-3-4-5(11)6(12,13)7(14,15)8(16,17)9(18,19)10(20,21)22/h5H,2-4H2,1H3 |
| InChIKey | SJHDERLDTYEPBA-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.17 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|