C13H23F5O3 — CID 151380849
2,2,3,3,4-pentafluoro-1,1,1-trimethoxydecane (PubChem CID 151380849) has the molecular formula C13H23F5O3 and a molecular weight of 322.31 g/mol. Its IUPAC name is 2,2,3,3,4-pentafluoro-1,1,1-trimethoxydecane.
| Compound Name | 2,2,3,3,4-pentafluoro-1,1,1-trimethoxydecane |
|---|---|
| PubChem CID | 151380849 |
| Molecular Formula | C13H23F5O3 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 2,2,3,3,4-pentafluoro-1,1,1-trimethoxydecane |
| SMILES | CCCCCCC(F)C(F)(F)C(F)(F)C(OC)(OC)OC |
| InChI | InChI=1S/C13H23F5O3/c1-5-6-7-8-9-10(14)11(15,16)12(17,18)13(19-2,20-3)21-4/h10H,5-9H2,1-4H3 |
| InChIKey | OSJLUSYEXXJWML-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|