C11H15F7O2 — CID 175755726
2,2,3,3,4,4,5-heptafluoroundecanoic acid (PubChem CID 175755726) has the molecular formula C11H15F7O2 and a molecular weight of 312.23 g/mol. Its IUPAC name is 2,2,3,3,4,4,5-heptafluoroundecanoic acid.
| Compound Name | 2,2,3,3,4,4,5-heptafluoroundecanoic acid |
|---|---|
| PubChem CID | 175755726 |
| Molecular Formula | C11H15F7O2 |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 2,2,3,3,4,4,5-heptafluoroundecanoic acid |
| SMILES | CCCCCCC(F)C(F)(F)C(F)(F)C(F)(F)C(=O)O |
| InChI | InChI=1S/C11H15F7O2/c1-2-3-4-5-6-7(12)9(13,14)11(17,18)10(15,16)8(19)20/h7H,2-6H2,1H3,(H,19,20) |
| InChIKey | VENAAQYMSRNJMG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|