C10H15F7O — CID 139615340
1,1,1,2,3,3,4-heptafluorodecan-2-ol (PubChem CID 139615340) has the molecular formula C10H15F7O and a molecular weight of 284.22 g/mol. Its IUPAC name is 1,1,1,2,3,3,4-heptafluorodecan-2-ol.
| Compound Name | 1,1,1,2,3,3,4-heptafluorodecan-2-ol |
|---|---|
| PubChem CID | 139615340 |
| Molecular Formula | C10H15F7O |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 1,1,1,2,3,3,4-heptafluorodecan-2-ol |
| SMILES | CCCCCCC(F)C(F)(F)C(O)(F)C(F)(F)F |
| InChI | InChI=1S/C10H15F7O/c1-2-3-4-5-6-7(11)8(12,13)9(14,18)10(15,16)17/h7,18H,2-6H2,1H3 |
| InChIKey | ZFFKROGJEFAOCI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|