C12H15F11O3S — CID 122480856
1,1,2,2,3,3,4,4,5,5,6-undecafluorododecane-1-sulfonic acid (PubChem CID 122480856) has the molecular formula C12H15F11O3S and a molecular weight of 448.29 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6-undecafluorododecane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6-undecafluorododecane-1-sulfonic acid |
|---|---|
| PubChem CID | 122480856 |
| Molecular Formula | C12H15F11O3S |
| Molecular Weight | 448.29 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6-undecafluorododecane-1-sulfonic acid |
| SMILES | CCCCCCC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C12H15F11O3S/c1-2-3-4-5-6-7(13)8(14,15)9(16,17)10(18,19)11(20,21)12(22,23)27(24,25)26/h7H,2-6H2,1H3,(H,24,25,26) |
| InChIKey | YVYQITUFEDZBCF-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.29 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|