C12H19F7O3S — CID 122480783
1,1,2,2,3,3,4-heptafluorododecane-1-sulfonic acid (PubChem CID 122480783) has the molecular formula C12H19F7O3S and a molecular weight of 376.33 g/mol. Its IUPAC name is 1,1,2,2,3,3,4-heptafluorododecane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3,4-heptafluorododecane-1-sulfonic acid |
|---|---|
| PubChem CID | 122480783 |
| Molecular Formula | C12H19F7O3S |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 1,1,2,2,3,3,4-heptafluorododecane-1-sulfonic acid |
| SMILES | CCCCCCCCC(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C12H19F7O3S/c1-2-3-4-5-6-7-8-9(13)10(14,15)11(16,17)12(18,19)23(20,21)22/h9H,2-8H2,1H3,(H,20,21,22) |
| InChIKey | WTZLUNRXNQVAAN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|