C18H17ClF20O4S — CID 175187693
2-(8-chloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,9-hexadecafluorohexadecoxy)-1,1,2,2-tetrafluoroethanesulfonic acid (PubChem CID 175187693) has the molecular formula C18H17ClF20O4S and a molecular weight of 744.81 g/mol. Its IUPAC name is 2-(8-chloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,9-hexadecafluorohexadecoxy)-1,1,2,2-tetrafluoroethanesulfonic acid.
| Compound Name | 2-(8-chloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,9-hexadecafluorohexadecoxy)-1,1,2,2-tetrafluoroethanesulfonic acid |
|---|---|
| PubChem CID | 175187693 |
| Molecular Formula | C18H17ClF20O4S |
| Molecular Weight | 744.81 g/mol |
| Exact Mass | 744.02 |
| IUPAC Name | 2-(8-chloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,9-hexadecafluorohexadecoxy)-1,1,2,2-tetrafluoroethanesulfonic acid |
| SMILES | CCCCCCCC(F)C(F)(Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C18H17ClF20O4S/c1-2-3-4-5-6-7-8(20)9(19,21)10(22,23)11(24,25)12(26,27)13(28,29)14(30,31)15(32,33)16(34,35)43-17(36,37)18(38,39)44(40,41)42/h8H,2-7H2,1H3,(H,40,41,42) |
| InChIKey | PBGSKBJVSKUEEF-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.81 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|