C16H31F5O3Si — CID 139987184
triethoxy(1,1,2,2,3-pentafluorodecyl)silane (PubChem CID 139987184) has the molecular formula C16H31F5O3Si and a molecular weight of 394.50 g/mol. Its IUPAC name is triethoxy(1,1,2,2,3-pentafluorodecyl)silane.
| Compound Name | triethoxy(1,1,2,2,3-pentafluorodecyl)silane |
|---|---|
| PubChem CID | 139987184 |
| Molecular Formula | C16H31F5O3Si |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | triethoxy(1,1,2,2,3-pentafluorodecyl)silane |
| SMILES | CCCCCCCC(F)C(F)(F)C(F)(F)[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C16H31F5O3Si/c1-5-9-10-11-12-13-14(17)15(18,19)16(20,21)25(22-6-2,23-7-3)24-8-4/h14H,5-13H2,1-4H3 |
| InChIKey | AEAOELXAYBORQX-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|