C16H29F7O3Si — CID 87687604
triethoxy(3,3,4,4,5,5,6-heptafluorodecyl)silane (PubChem CID 87687604) has the molecular formula C16H29F7O3Si and a molecular weight of 430.48 g/mol. Its IUPAC name is triethoxy(3,3,4,4,5,5,6-heptafluorodecyl)silane.
| Compound Name | triethoxy(3,3,4,4,5,5,6-heptafluorodecyl)silane |
|---|---|
| PubChem CID | 87687604 |
| Molecular Formula | C16H29F7O3Si |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | triethoxy(3,3,4,4,5,5,6-heptafluorodecyl)silane |
| SMILES | CCCCC(F)C(F)(F)C(F)(F)C(F)(F)CC[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C16H29F7O3Si/c1-5-9-10-13(17)15(20,21)16(22,23)14(18,19)11-12-27(24-6-2,25-7-3)26-8-4/h13H,5-12H2,1-4H3 |
| InChIKey | HNIRKNQGUQOOCO-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|