C9H10BrF9 — CID 175517627
1-bromo-1,1,2,2,3,3,4,4,5-nonafluorononane (PubChem CID 175517627) has the molecular formula C9H10BrF9 and a molecular weight of 369.07 g/mol. Its IUPAC name is 1-bromo-1,1,2,2,3,3,4,4,5-nonafluorononane.
| Compound Name | 1-bromo-1,1,2,2,3,3,4,4,5-nonafluorononane |
|---|---|
| PubChem CID | 175517627 |
| Molecular Formula | C9H10BrF9 |
| Molecular Weight | 369.07 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | 1-bromo-1,1,2,2,3,3,4,4,5-nonafluorononane |
| SMILES | CCCCC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Br |
| InChI | InChI=1S/C9H10BrF9/c1-2-3-4-5(11)6(12,13)7(14,15)8(16,17)9(10,18)19/h5H,2-4H2,1H3 |
| InChIKey | LYXRBWSMEDSSOF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.07 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|