C12H11F15 — CID 123425795
1,1,1,2,2,3,3,4,4,5,6,6,7,7,8-pentadecafluorododecane (PubChem CID 123425795) has the molecular formula C12H11F15 and a molecular weight of 440.19 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,6,6,7,7,8-pentadecafluorododecane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,6,6,7,7,8-pentadecafluorododecane |
|---|---|
| PubChem CID | 123425795 |
| Molecular Formula | C12H11F15 |
| Molecular Weight | 440.19 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,6,6,7,7,8-pentadecafluorododecane |
| SMILES | CCCCC(F)C(F)(F)C(F)(F)C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H11F15/c1-2-3-4-5(13)7(15,16)8(17,18)6(14)9(19,20)10(21,22)11(23,24)12(25,26)27/h5-6H,2-4H2,1H3 |
| InChIKey | CRSJFPUWWWWHDX-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.19 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|