C16H18F18O3Si — CID 21254451
triethoxy(2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodecyl)silane (PubChem CID 21254451) has the molecular formula C16H18F18O3Si and a molecular weight of 628.37 g/mol. Its IUPAC name is triethoxy(2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodecyl)silane.
| Compound Name | triethoxy(2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodecyl)silane |
|---|---|
| PubChem CID | 21254451 |
| Molecular Formula | C16H18F18O3Si |
| Molecular Weight | 628.37 g/mol |
| Exact Mass | 628.07 |
| IUPAC Name | triethoxy(2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodecyl)silane |
| SMILES | CCO[Si](CC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(OCC)OCC |
| InChI | InChI=1S/C16H18F18O3Si/c1-4-35-38(36-5-2,37-6-3)7-8(17)9(18,19)10(20,21)11(22,23)12(24,25)13(26,27)14(28,29)15(30,31)16(32,33)34/h8H,4-7H2,1-3H3 |
| InChIKey | PNRQYZZIHKRGCG-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.37 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|