C16H16F20O3Si — CID 22721486
triethoxy(1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-icosafluorodecyl)silane (PubChem CID 22721486) has the molecular formula C16H16F20O3Si and a molecular weight of 664.35 g/mol. Its IUPAC name is triethoxy(1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-icosafluorodecyl)silane.
| Compound Name | triethoxy(1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-icosafluorodecyl)silane |
|---|---|
| PubChem CID | 22721486 |
| Molecular Formula | C16H16F20O3Si |
| Molecular Weight | 664.35 g/mol |
| Exact Mass | 664.05 |
| IUPAC Name | triethoxy(1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-icosafluorodecyl)silane |
| SMILES | CCO[Si](OCC)(OCC)C(F)(F)C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H16F20O3Si/c1-4-37-40(38-5-2,39-6-3)9(20,21)7(17)8(18,19)10(22,23)11(24,25)12(26,27)13(28,29)14(30,31)15(32,33)16(34,35)36/h7H,4-6H2,1-3H3 |
| InChIKey | ZTOVUXJFOFUFBE-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.35 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|