C24H31F25O6Si2 — CID 159378661
triethoxy(1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctyl)silane;triethoxy-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]silane (PubChem CID 159378661) has the molecular formula C24H31F25O6Si2 and a molecular weight of 946.63 g/mol. Its IUPAC name is triethoxy(1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctyl)silane;triethoxy-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]silane.
| Compound Name | triethoxy(1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctyl)silane;triethoxy-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]silane |
|---|---|
| PubChem CID | 159378661 |
| Molecular Formula | C24H31F25O6Si2 |
| Molecular Weight | 946.63 g/mol |
| Exact Mass | 946.13 |
| IUPAC Name | triethoxy(1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluorooctyl)silane;triethoxy-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]silane |
| SMILES | CCO[Si](OCC)(OCC)C(C(F)(F)F)(C(F)(F)F)C(F)(F)F.CCO[Si](OCC)(OCC)C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H16F16O3Si.C10H15F9O3Si/c1-4-31-34(32-5-2,33-6-3)7(15)8(16,17)9(18,19)10(20,21)11(22,23)12(24,25)13(26,27)14(28,29)30;1-4-20-23(21-5-2,22-6-3)7(8(11,12)13,9(14,15)16)10(17,18)19/h7H,4-6H2,1-3H3;4-6H2,1-3H3 |
| InChIKey | LKQCCPDNLQDOHL-UHFFFAOYSA-N |
| XLogP | 10.75 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 946.63 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|