C13H12F18O3Si — CID 87176354
trimethoxy(1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodecyl)silane (PubChem CID 87176354) has the molecular formula C13H12F18O3Si and a molecular weight of 586.29 g/mol. Its IUPAC name is trimethoxy(1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodecyl)silane.
| Compound Name | trimethoxy(1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodecyl)silane |
|---|---|
| PubChem CID | 87176354 |
| Molecular Formula | C13H12F18O3Si |
| Molecular Weight | 586.29 g/mol |
| Exact Mass | 586.03 |
| IUPAC Name | trimethoxy(1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodecyl)silane |
| SMILES | CO[Si](OC)(OC)C(F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H12F18O3Si/c1-32-35(33-2,34-3)5(14)4-6(15,16)7(17,18)8(19,20)9(21,22)10(23,24)11(25,26)12(27,28)13(29,30)31/h5H,4H2,1-3H3 |
| InChIKey | WMTBQHXEYDQYOU-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.29 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|